C17H18N2O4S — CID 9062741
[(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate (PubChem CID 9062741) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate.
| Compound Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 9062741 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate |
| SMILES | C[C@H](OC(=O)CCc1ccsc1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-12(23-15(20)8-7-13-9-10-24-11-13)16(21)18-19-17(22)14-5-3-2-4-6-14/h2-6,9-12H,7-8H2,1H3,(H,18,21)(H,19,22)/t12-/m0/s1 |
| InChIKey | YDBKRLPNMARUQS-LBPRGKRZSA-N |
| XLogP | 2.07 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|