C20H27NO3S — CID 8654611
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate (PubChem CID 8654611) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 8654611 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3-thiophen-3-ylpropanoate |
| SMILES | C[C@@H](OC(=O)CCc1ccsc1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H27NO3S/c1-13(24-18(22)3-2-14-4-5-25-12-14)19(23)21-20-9-15-6-16(10-20)8-17(7-15)11-20/h4-5,12-13,15-17H,2-3,6-11H2,1H3,(H,21,23)/t13-,15?,16?,17?,20?/m1/s1 |
| InChIKey | DLFPVWYLTZJFHB-SFAMEIPESA-N |
| XLogP | 3.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |