C20H27NO3S2 — CID 8506174
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(thiophen-2-ylmethylsulfanyl)acetate (PubChem CID 8506174) has the molecular formula C20H27NO3S2 and a molecular weight of 393.57 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(thiophen-2-ylmethylsulfanyl)acetate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
|---|---|
| PubChem CID | 8506174 |
| Molecular Formula | C20H27NO3S2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
| SMILES | C[C@@H](OC(=O)CSCc1cccs1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H27NO3S2/c1-13(24-18(22)12-25-11-17-3-2-4-26-17)19(23)21-20-8-14-5-15(9-20)7-16(6-14)10-20/h2-4,13-16H,5-12H2,1H3,(H,21,23)/t13-,14?,15?,16?,20?/m1/s1 |
| InChIKey | JPOKEBZVFFWHJB-XXWNAHEMSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |