C22H30N2O4S — CID 9483969
[(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate (PubChem CID 9483969) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate.
| Compound Name | [(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 9483969 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate |
| SMILES | C[C@@H](OC(=O)CCCc1cccs1)C(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H30N2O4S/c1-14(28-19(25)6-2-4-18-5-3-7-29-18)20(26)23-21(27)24-22-11-15-8-16(12-22)10-17(9-15)13-22/h3,5,7,14-17H,2,4,6,8-13H2,1H3,(H2,23,24,26,27)/t14-,15?,16?,17?,22?/m1/s1 |
| InChIKey | PDCZHLKGRNGNHV-XSXQVXRUSA-N |
| XLogP | 3.80 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |