C18H20N2O4S — CID 7962901
[(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-thiophen-2-ylbutanoate (PubChem CID 7962901) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-thiophen-2-ylbutanoate.
| Compound Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7962901 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-thiophen-2-ylbutanoate |
| SMILES | CNC(=O)NC(=O)[C@@H](OC(=O)CCCc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-19-18(23)20-17(22)16(13-7-3-2-4-8-13)24-15(21)11-5-9-14-10-6-12-25-14/h2-4,6-8,10,12,16H,5,9,11H2,1H3,(H2,19,20,22,23)/t16-/m0/s1 |
| InChIKey | AWMBSHMGSQWNBT-INIZCTEOSA-N |
| XLogP | 2.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |