C17H17N3O5S — CID 7808145
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(thiophene-2-carbonylamino)acetate (PubChem CID 7808145) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(thiophene-2-carbonylamino)acetate.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(thiophene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7808145 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(thiophene-2-carbonylamino)acetate |
| SMILES | CNC(=O)NC(=O)[C@H](OC(=O)CNC(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O5S/c1-18-17(24)20-16(23)14(11-6-3-2-4-7-11)25-13(21)10-19-15(22)12-8-5-9-26-12/h2-9,14H,10H2,1H3,(H,19,22)(H2,18,20,23,24)/t14-/m1/s1 |
| InChIKey | RFPRFGQDLBQJFT-CQSZACIVSA-N |
| XLogP | 1.22 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |