C17H18N2O4S — CID 7799353
[(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-thiophen-2-ylacetate (PubChem CID 7799353) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-thiophen-2-ylacetate.
| Compound Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 7799353 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-thiophen-2-ylacetate |
| SMILES | CCNC(=O)NC(=O)[C@H](OC(=O)Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-2-18-17(22)19-16(21)15(12-7-4-3-5-8-12)23-14(20)11-13-9-6-10-24-13/h3-10,15H,2,11H2,1H3,(H2,18,19,21,22)/t15-/m1/s1 |
| InChIKey | CPXFVYLRMDKFCU-OAHLLOKOSA-N |
| XLogP | 2.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |