C17H18N2O4S — CID 7837729
[(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-methylthiophene-2-carboxylate (PubChem CID 7837729) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7837729 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-methylthiophene-2-carboxylate |
| SMILES | CCNC(=O)NC(=O)[C@H](OC(=O)c1sccc1C)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-3-18-17(22)19-15(20)13(12-7-5-4-6-8-12)23-16(21)14-11(2)9-10-24-14/h4-10,13H,3H2,1-2H3,(H2,18,19,20,22)/t13-/m1/s1 |
| InChIKey | QIIYENQBPUTFPD-CYBMUJFWSA-N |
| XLogP | 2.80 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |