C20H22N2O4 — CID 7765259
[(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2,3-dimethylbenzoate (PubChem CID 7765259) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2,3-dimethylbenzoate.
| Compound Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 7765259 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2,3-dimethylbenzoate |
| SMILES | CCNC(=O)NC(=O)[C@@H](OC(=O)c1cccc(C)c1C)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O4/c1-4-21-20(25)22-18(23)17(15-10-6-5-7-11-15)26-19(24)16-12-8-9-13(2)14(16)3/h5-12,17H,4H2,1-3H3,(H2,21,22,23,25)/t17-/m0/s1 |
| InChIKey | UBFHGAWRMXDBPS-KRWDZBQOSA-N |
| XLogP | 3.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |