C22H21N3O4 — CID 7351543
[(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-methylquinoline-4-carboxylate (PubChem CID 7351543) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-methylquinoline-4-carboxylate.
| Compound Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7351543 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-methylquinoline-4-carboxylate |
| SMILES | CCNC(=O)NC(=O)[C@@H](OC(=O)c1cc(C)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C22H21N3O4/c1-3-23-22(28)25-20(26)19(15-9-5-4-6-10-15)29-21(27)17-13-14(2)24-18-12-8-7-11-16(17)18/h4-13,19H,3H2,1-2H3,(H2,23,25,26,28)/t19-/m0/s1 |
| InChIKey | ZLJLNDNOCIRWHX-IBGZPJMESA-N |
| XLogP | 3.29 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |