C18H17FN2O4 — CID 7864310
[(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-fluorobenzoate (PubChem CID 7864310) has the molecular formula C18H17FN2O4 and a molecular weight of 344.34 g/mol. Its IUPAC name is [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-fluorobenzoate.
| Compound Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 7864310 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-fluorobenzoate |
| SMILES | CCNC(=O)NC(=O)[C@H](OC(=O)c1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C18H17FN2O4/c1-2-20-18(24)21-16(22)15(12-8-4-3-5-9-12)25-17(23)13-10-6-7-11-14(13)19/h3-11,15H,2H2,1H3,(H2,20,21,22,24)/t15-/m1/s1 |
| InChIKey | FUQLYVRSMAOIBZ-OAHLLOKOSA-N |
| XLogP | 2.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |