C14H18N2O4 — CID 7851438
[(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] propanoate (PubChem CID 7851438) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] propanoate.
| Compound Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] propanoate |
|---|---|
| PubChem CID | 7851438 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] propanoate |
| SMILES | CCNC(=O)NC(=O)[C@H](OC(=O)CC)c1ccccc1 |
| InChI | InChI=1S/C14H18N2O4/c1-3-11(17)20-12(10-8-6-5-7-9-10)13(18)16-14(19)15-4-2/h5-9,12H,3-4H2,1-2H3,(H2,15,16,18,19)/t12-/m1/s1 |
| InChIKey | DYRIISMCESSEDW-GFCCVEGCSA-N |
| XLogP | 1.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |