C19H20N2O4 — CID 7875023
[(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-phenylacetate (PubChem CID 7875023) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-phenylacetate.
| Compound Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-phenylacetate |
|---|---|
| PubChem CID | 7875023 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-phenylacetate |
| SMILES | CCNC(=O)NC(=O)[C@@H](OC(=O)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c1-2-20-19(24)21-18(23)17(15-11-7-4-8-12-15)25-16(22)13-14-9-5-3-6-10-14/h3-12,17H,2,13H2,1H3,(H2,20,21,23,24)/t17-/m0/s1 |
| InChIKey | ZSWWPDKHJNOHIN-KRWDZBQOSA-N |
| XLogP | 2.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |