C19H20N2O5S — CID 7810050
[(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 7810050) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7810050 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | CCNC(=O)NC(=O)[C@H](OC(=O)CCC(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O5S/c1-2-20-19(25)21-18(24)17(13-7-4-3-5-8-13)26-16(23)11-10-14(22)15-9-6-12-27-15/h3-9,12,17H,2,10-11H2,1H3,(H2,20,21,24,25)/t17-/m1/s1 |
| InChIKey | CWJFLEKNGDAJOD-QGZVFWFLSA-N |
| XLogP | 2.84 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |