C19H19NO4S — CID 55390691
[2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 55390691) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 55390691 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | O=C(CCC(=O)c1cccs1)OC(C(=O)NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO4S/c21-15(16-7-4-12-25-16)10-11-17(22)24-18(13-5-2-1-3-6-13)19(23)20-14-8-9-14/h1-7,12,14,18H,8-11H2,(H,20,23) |
| InChIKey | GQQVBCVJPXQLJU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |