C24H28N2O5S — CID 24519816
(2-oxo-1-phenyl-2-piperidin-1-ylethyl) 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate (PubChem CID 24519816) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate.
| Compound Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 24519816 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoate |
| SMILES | O=C(CCC(=O)c1cccs1)NCCC(=O)OC(C(=O)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O5S/c27-19(20-10-7-17-32-20)11-12-21(28)25-14-13-22(29)31-23(18-8-3-1-4-9-18)24(30)26-15-5-2-6-16-26/h1,3-4,7-10,17,23H,2,5-6,11-16H2,(H,25,28) |
| InChIKey | HLDJXDJDEITJKJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |