C12H17NO4S — CID 108796357
N-(2,2-dimethoxyethyl)-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 108796357) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 108796357 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | COC(CNC(=O)CCC(=O)c1cccs1)OC |
| InChI | InChI=1S/C12H17NO4S/c1-16-12(17-2)8-13-11(15)6-5-9(14)10-4-3-7-18-10/h3-4,7,12H,5-6,8H2,1-2H3,(H,13,15) |
| InChIKey | YNMURYZFPQGAKQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|