C14H18N2O4S — CID 110346802
methyl 4-(4-oxo-4-thiophen-2-ylbutanoyl)piperazine-1-carboxylate (PubChem CID 110346802) has the molecular formula C14H18N2O4S and a molecular weight of 310.37 g/mol. Its IUPAC name is methyl 4-(4-oxo-4-thiophen-2-ylbutanoyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-(4-oxo-4-thiophen-2-ylbutanoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110346802 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | methyl 4-(4-oxo-4-thiophen-2-ylbutanoyl)piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)CCC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C14H18N2O4S/c1-20-14(19)16-8-6-15(7-9-16)13(18)5-4-11(17)12-3-2-10-21-12/h2-3,10H,4-9H2,1H3 |
| InChIKey | MQSAUELWXSUQFL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |