C19H27N3O3S — CID 110346795
N-cyclohexyl-4-(4-oxo-4-thiophen-2-ylbutanoyl)piperazine-1-carboxamide (PubChem CID 110346795) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-cyclohexyl-4-(4-oxo-4-thiophen-2-ylbutanoyl)piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(4-oxo-4-thiophen-2-ylbutanoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110346795 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | N-cyclohexyl-4-(4-oxo-4-thiophen-2-ylbutanoyl)piperazine-1-carboxamide |
| SMILES | O=C(CCC(=O)N1CCN(C(=O)NC2CCCCC2)CC1)c1cccs1 |
| InChI | InChI=1S/C19H27N3O3S/c23-16(17-7-4-14-26-17)8-9-18(24)21-10-12-22(13-11-21)19(25)20-15-5-2-1-3-6-15/h4,7,14-15H,1-3,5-6,8-13H2,(H,20,25) |
| InChIKey | SKELWGIIKQJYBJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |