C20H28N2O3S — CID 167863555
4-cyclobutyl-N-[1-(4-oxo-4-thiophen-2-ylbutanoyl)pyrrolidin-3-yl]butanamide (PubChem CID 167863555) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 4-cyclobutyl-N-[1-(4-oxo-4-thiophen-2-ylbutanoyl)pyrrolidin-3-yl]butanamide.
| Compound Name | 4-cyclobutyl-N-[1-(4-oxo-4-thiophen-2-ylbutanoyl)pyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 167863555 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 4-cyclobutyl-N-[1-(4-oxo-4-thiophen-2-ylbutanoyl)pyrrolidin-3-yl]butanamide |
| SMILES | O=C(CCCC1CCC1)NC1CCN(C(=O)CCC(=O)c2cccs2)C1 |
| InChI | InChI=1S/C20H28N2O3S/c23-17(18-7-3-13-26-18)9-10-20(25)22-12-11-16(14-22)21-19(24)8-2-6-15-4-1-5-15/h3,7,13,15-16H,1-2,4-6,8-12,14H2,(H,21,24) |
| InChIKey | BYBQNCKCWHKIBN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |