C16H25ClN2O3S — CID 119661499
1-[4-(3-aminopropoxy)piperidin-1-yl]-4-thiophen-2-ylbutane-1,4-dione;hydrochloride (PubChem CID 119661499) has the molecular formula C16H25ClN2O3S and a molecular weight of 360.91 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-4-thiophen-2-ylbutane-1,4-dione;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-4-thiophen-2-ylbutane-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 119661499 |
| Molecular Formula | C16H25ClN2O3S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-4-thiophen-2-ylbutane-1,4-dione;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)CCC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H24N2O3S.ClH/c17-8-2-11-21-13-6-9-18(10-7-13)16(20)5-4-14(19)15-3-1-12-22-15;/h1,3,12-13H,2,4-11,17H2;1H |
| InChIKey | RDYJSDPPBQXNCI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|