C19H30ClN3O3S — CID 119662017
[4-(3-aminopropoxy)piperidin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-2-yl]methanone;hydrochloride (PubChem CID 119662017) has the molecular formula C19H30ClN3O3S and a molecular weight of 415.99 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-2-yl]methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119662017 |
| Molecular Formula | C19H30ClN3O3S |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[1-(thiophene-2-carbonyl)piperidin-2-yl]methanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)C2CCCCN2C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H29N3O3S.ClH/c20-9-4-13-25-15-7-11-21(12-8-15)18(23)16-5-1-2-10-22(16)19(24)17-6-3-14-26-17;/h3,6,14-16H,1-2,4-5,7-13,20H2;1H |
| InChIKey | ZFGQGULKPIUODM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|