C24H29N3O3S — CID 24674548
N-benzyl-1-[1-(thiophene-2-carbonyl)piperidine-2-carbonyl]piperidine-4-carboxamide (PubChem CID 24674548) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-benzyl-1-[1-(thiophene-2-carbonyl)piperidine-2-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[1-(thiophene-2-carbonyl)piperidine-2-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24674548 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-benzyl-1-[1-(thiophene-2-carbonyl)piperidine-2-carbonyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CCN(C(=O)C2CCCCN2C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C24H29N3O3S/c28-22(25-17-18-7-2-1-3-8-18)19-11-14-26(15-12-19)23(29)20-9-4-5-13-27(20)24(30)21-10-6-16-31-21/h1-3,6-8,10,16,19-20H,4-5,9,11-15,17H2,(H,25,28) |
| InChIKey | ODGILTRMJGTTBQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |