C16H23N3O2S — CID 119414809
1,4-diazepan-1-yl-[1-(thiophene-2-carbonyl)piperidin-2-yl]methanone (PubChem CID 119414809) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[1-(thiophene-2-carbonyl)piperidin-2-yl]methanone.
| Compound Name | 1,4-diazepan-1-yl-[1-(thiophene-2-carbonyl)piperidin-2-yl]methanone |
|---|---|
| PubChem CID | 119414809 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1,4-diazepan-1-yl-[1-(thiophene-2-carbonyl)piperidin-2-yl]methanone |
| SMILES | O=C(C1CCCCN1C(=O)c1cccs1)N1CCCNCC1 |
| InChI | InChI=1S/C16H23N3O2S/c20-15(18-9-4-7-17-8-11-18)13-5-1-2-10-19(13)16(21)14-6-3-12-22-14/h3,6,12-13,17H,1-2,4-5,7-11H2 |
| InChIKey | JFZVRMJZNHIGQK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |