C14H24ClN3O4S2 — CID 119663314
N-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride (PubChem CID 119663314) has the molecular formula C14H24ClN3O4S2 and a molecular weight of 397.95 g/mol. Its IUPAC name is N-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119663314 |
| Molecular Formula | C14H24ClN3O4S2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)CNS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C14H23N3O4S2.ClH/c15-6-2-9-21-12-4-7-17(8-5-12)13(18)11-16-23(19,20)14-3-1-10-22-14;/h1,3,10,12,16H,2,4-9,11,15H2;1H |
| InChIKey | JZGAKRDVGQQFPW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|