C12H17N3O4S2 — CID 39888506
N-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide (PubChem CID 39888506) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 39888506 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide |
| SMILES | CC(=O)N1CCN(C(=O)CNS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C12H17N3O4S2/c1-10(16)14-4-6-15(7-5-14)11(17)9-13-21(18,19)12-3-2-8-20-12/h2-3,8,13H,4-7,9H2,1H3 |
| InChIKey | WSCBUSPRQYCBPI-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |