C14H17N5O3S2 — CID 22583185
N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 22583185) has the molecular formula C14H17N5O3S2 and a molecular weight of 367.46 g/mol. Its IUPAC name is N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22583185 |
| Molecular Formula | C14H17N5O3S2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H17N5O3S2/c20-12(11-17-24(21,22)13-3-1-10-23-13)18-6-8-19(9-7-18)14-15-4-2-5-16-14/h1-5,10,17H,6-9,11H2 |
| InChIKey | COZMYLLSXJRGMO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |