C17H20N4O5S2 — CID 43065293
[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl] 2-(thiophen-2-ylsulfonylamino)acetate (PubChem CID 43065293) has the molecular formula C17H20N4O5S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is [2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl] 2-(thiophen-2-ylsulfonylamino)acetate.
| Compound Name | [2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 43065293 |
| Molecular Formula | C17H20N4O5S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)OCC(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H20N4O5S2/c22-15(21-9-7-20(8-10-21)14-4-1-2-6-18-14)13-26-16(23)12-19-28(24,25)17-5-3-11-27-17/h1-6,11,19H,7-10,12-13H2 |
| InChIKey | DPMZPAFWECXIOD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |