C18H20FN3O5S2 — CID 55705020
[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate (PubChem CID 55705020) has the molecular formula C18H20FN3O5S2 and a molecular weight of 441.51 g/mol. Its IUPAC name is [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate.
| Compound Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 55705020 |
| Molecular Formula | C18H20FN3O5S2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)OCC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H20FN3O5S2/c19-14-3-5-15(6-4-14)21-7-9-22(10-8-21)16(23)13-27-17(24)12-20-29(25,26)18-2-1-11-28-18/h1-6,11,20H,7-10,12-13H2 |
| InChIKey | WAHSYJWJQHIIQE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |