C21H21BrFN3O4 — CID 31228874
[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate (PubChem CID 31228874) has the molecular formula C21H21BrFN3O4 and a molecular weight of 478.32 g/mol. Its IUPAC name is [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate.
| Compound Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 31228874 |
| Molecular Formula | C21H21BrFN3O4 |
| Molecular Weight | 478.32 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)OCC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H21BrFN3O4/c22-16-3-1-2-15(12-16)21(29)24-13-20(28)30-14-19(27)26-10-8-25(9-11-26)18-6-4-17(23)5-7-18/h1-7,12H,8-11,13-14H2,(H,24,29) |
| InChIKey | XPCXNZPNXMOSAY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |