C16H19BrN2O4 — CID 35661902
(2-oxo-2-piperidin-1-ylethyl) 2-[(3-bromobenzoyl)amino]acetate (PubChem CID 35661902) has the molecular formula C16H19BrN2O4 and a molecular weight of 383.24 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2-[(3-bromobenzoyl)amino]acetate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2-[(3-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 35661902 |
| Molecular Formula | C16H19BrN2O4 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2-[(3-bromobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H19BrN2O4/c17-13-6-4-5-12(9-13)16(22)18-10-15(21)23-11-14(20)19-7-2-1-3-8-19/h4-6,9H,1-3,7-8,10-11H2,(H,18,22) |
| InChIKey | TYOKWTKUVJVLKB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |