C17H21BrN2O4 — CID 55320566
[2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate (PubChem CID 55320566) has the molecular formula C17H21BrN2O4 and a molecular weight of 397.27 g/mol. Its IUPAC name is [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate.
| Compound Name | [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55320566 |
| Molecular Formula | C17H21BrN2O4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [2-(2-methylpiperidin-1-yl)-2-oxoethyl] 2-[(3-bromobenzoyl)amino]acetate |
| SMILES | CC1CCCCN1C(=O)COC(=O)CNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H21BrN2O4/c1-12-5-2-3-8-20(12)15(21)11-24-16(22)10-19-17(23)13-6-4-7-14(18)9-13/h4,6-7,9,12H,2-3,5,8,10-11H2,1H3,(H,19,23) |
| InChIKey | FJJIBHCWEXVRGR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |