C22H24N2O4 — CID 8921487
(2-oxo-2-piperidin-1-ylethyl) 2-[(4-phenylbenzoyl)amino]acetate (PubChem CID 8921487) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2-[(4-phenylbenzoyl)amino]acetate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2-[(4-phenylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8921487 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2-[(4-phenylbenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(-c2ccccc2)cc1)OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H24N2O4/c25-20(24-13-5-2-6-14-24)16-28-21(26)15-23-22(27)19-11-9-18(10-12-19)17-7-3-1-4-8-17/h1,3-4,7-12H,2,5-6,13-16H2,(H,23,27) |
| InChIKey | GMWNQWIITBYFTL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |