About [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate
[2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate (PubChem CID 23990780) has the molecular formula C15H18BrNO3
and a molecular weight of 340.22 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate.
Molecular Properties
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate |
| PubChem CID | 23990780 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate |
| SMILES | O=C(OCC(=O)N1CCCCCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H18BrNO3/c16-13-7-5-6-12(10-13)15(19)20-11-14(18)17-8-3-1-2-4-9-17/h5-7,10H,1-4,8-9,11H2 |
| InChIKey | LYNOUEXEHCROGG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate?
The IUPAC name of [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate (CID 23990780) is [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate.
What is the SMILES notation for [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate?
The canonical SMILES for [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate is O=C(OCC(=O)N1CCCCCC1)c1cccc(Br)c1.
What is the InChIKey of [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate?
The InChIKey is LYNOUEXEHCROGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrNO3/c16-13-7-5-6-12(10-13)15(19)20-11-14(18)17-8-3-1-2-4-9-17/h5-7,10H,1-4,8-9,11H2.
What are the key properties of [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate?
[2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate has a molecular weight of 340.22 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(azepan-1-yl)-2-oxoethyl] 3-bromobenzoate is sourced from PubChem (CID 23990780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).