C25H23BrFN3O2 — CID 42663751
3-bromo-N-[4-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]phenyl]benzamide (PubChem CID 42663751) has the molecular formula C25H23BrFN3O2 and a molecular weight of 496.38 g/mol. Its IUPAC name is 3-bromo-N-[4-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3-bromo-N-[4-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42663751 |
| Molecular Formula | C25H23BrFN3O2 |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 3-bromo-N-[4-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)Cc3ccc(F)cc3)CC2)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C25H23BrFN3O2/c26-20-3-1-2-19(17-20)25(32)28-22-8-10-23(11-9-22)29-12-14-30(15-13-29)24(31)16-18-4-6-21(27)7-5-18/h1-11,17H,12-16H2,(H,28,32) |
| InChIKey | LVAWYBKJLDYKFU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|