C27H28FN3O2 — CID 1057942
2-(4-fluorophenyl)-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]acetamide (PubChem CID 1057942) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 1057942 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]acetamide |
| SMILES | Cc1cccc(CC(=O)N2CCN(c3ccc(NC(=O)Cc4ccc(F)cc4)cc3)CC2)c1 |
| InChI | InChI=1S/C27H28FN3O2/c1-20-3-2-4-22(17-20)19-27(33)31-15-13-30(14-16-31)25-11-9-24(10-12-25)29-26(32)18-21-5-7-23(28)8-6-21/h2-12,17H,13-16,18-19H2,1H3,(H,29,32) |
| InChIKey | SMCLYSOBMZUUKF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|