C26H27FN4O2 — CID 1058047
1-(3-fluorophenyl)-3-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea (PubChem CID 1058047) has the molecular formula C26H27FN4O2 and a molecular weight of 446.53 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 1058047 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea |
| SMILES | Cc1cccc(CC(=O)N2CCN(c3ccc(NC(=O)Nc4cccc(F)c4)cc3)CC2)c1 |
| InChI | InChI=1S/C26H27FN4O2/c1-19-4-2-5-20(16-19)17-25(32)31-14-12-30(13-15-31)24-10-8-22(9-11-24)28-26(33)29-23-7-3-6-21(27)18-23/h2-11,16,18H,12-15,17H2,1H3,(H2,28,29,33) |
| InChIKey | RENXROMHLYDYAI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|