C25H33N3O — CID 113079066
2-(3-methylphenyl)-1-[4-[4-(4-methylpiperidin-1-yl)phenyl]piperazin-1-yl]ethanone (PubChem CID 113079066) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is 2-(3-methylphenyl)-1-[4-[4-(4-methylpiperidin-1-yl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(3-methylphenyl)-1-[4-[4-(4-methylpiperidin-1-yl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 113079066 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 2-(3-methylphenyl)-1-[4-[4-(4-methylpiperidin-1-yl)phenyl]piperazin-1-yl]ethanone |
| SMILES | Cc1cccc(CC(=O)N2CCN(c3ccc(N4CCC(C)CC4)cc3)CC2)c1 |
| InChI | InChI=1S/C25H33N3O/c1-20-10-12-26(13-11-20)23-6-8-24(9-7-23)27-14-16-28(17-15-27)25(29)19-22-5-3-4-21(2)18-22/h3-9,18,20H,10-17,19H2,1-2H3 |
| InChIKey | UAYPBLPXKXJJSM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|