C26H27BrN4O2 — CID 1058051
1-(2-bromophenyl)-3-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea (PubChem CID 1058051) has the molecular formula C26H27BrN4O2 and a molecular weight of 507.43 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 1058051 |
| Molecular Formula | C26H27BrN4O2 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 1-(2-bromophenyl)-3-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]urea |
| SMILES | Cc1cccc(CC(=O)N2CCN(c3ccc(NC(=O)Nc4ccccc4Br)cc3)CC2)c1 |
| InChI | InChI=1S/C26H27BrN4O2/c1-19-5-4-6-20(17-19)18-25(32)31-15-13-30(14-16-31)22-11-9-21(10-12-22)28-26(33)29-24-8-3-2-7-23(24)27/h2-12,17H,13-16,18H2,1H3,(H2,28,29,33) |
| InChIKey | WLHMZHUWFVDSBO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|