C29H35N3O3S — CID 1058123
4-tert-butyl-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]benzenesulfonamide (PubChem CID 1058123) has the molecular formula C29H35N3O3S and a molecular weight of 505.68 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1058123 |
| Molecular Formula | C29H35N3O3S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 4-tert-butyl-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]benzenesulfonamide |
| SMILES | Cc1cccc(CC(=O)N2CCN(c3ccc(NS(=O)(=O)c4ccc(C(C)(C)C)cc4)cc3)CC2)c1 |
| InChI | InChI=1S/C29H35N3O3S/c1-22-6-5-7-23(20-22)21-28(33)32-18-16-31(17-19-32)26-12-10-25(11-13-26)30-36(34,35)27-14-8-24(9-15-27)29(2,3)4/h5-15,20,30H,16-19,21H2,1-4H3 |
| InChIKey | KCXDZYBCPTUTJP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|