C26H26FN3O2 — CID 1057923
3-fluoro-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]benzamide (PubChem CID 1057923) has the molecular formula C26H26FN3O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 3-fluoro-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 1057923 |
| Molecular Formula | C26H26FN3O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-fluoro-N-[4-[4-[2-(3-methylphenyl)acetyl]piperazin-1-yl]phenyl]benzamide |
| SMILES | Cc1cccc(CC(=O)N2CCN(c3ccc(NC(=O)c4cccc(F)c4)cc3)CC2)c1 |
| InChI | InChI=1S/C26H26FN3O2/c1-19-4-2-5-20(16-19)17-25(31)30-14-12-29(13-15-30)24-10-8-23(9-11-24)28-26(32)21-6-3-7-22(27)18-21/h2-11,16,18H,12-15,17H2,1H3,(H,28,32) |
| InChIKey | ILUSLZZYNIVXFR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|