C22H20FN3O3 — CID 649966
3-fluoro-N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 649966) has the molecular formula C22H20FN3O3 and a molecular weight of 393.42 g/mol. Its IUPAC name is 3-fluoro-N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 649966 |
| Molecular Formula | C22H20FN3O3 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-fluoro-N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H20FN3O3/c23-17-4-1-3-16(15-17)21(27)24-18-6-8-19(9-7-18)25-10-12-26(13-11-25)22(28)20-5-2-14-29-20/h1-9,14-15H,10-13H2,(H,24,27) |
| InChIKey | TVAWYLJKXMIGDV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|