C18H21FN3O+ — CID 6957194
3-fluoro-N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]benzamide (PubChem CID 6957194) has the molecular formula C18H21FN3O+ and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-fluoro-N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 6957194 |
| Molecular Formula | C18H21FN3O+ |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-fluoro-N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]benzamide |
| SMILES | C[NH+]1CCN(c2ccc(NC(=O)c3cccc(F)c3)cc2)CC1 |
| InChI | InChI=1S/C18H20FN3O/c1-21-9-11-22(12-10-21)17-7-5-16(6-8-17)20-18(23)14-3-2-4-15(19)13-14/h2-8,13H,9-12H2,1H3,(H,20,23)/p+1 |
| InChIKey | SIMJARLFJUOEHC-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|