C19H21N3O3 — CID 112984587
N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]cyclopropanecarboxamide (PubChem CID 112984587) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 112984587 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)cc1)C1CC1 |
| InChI | InChI=1S/C19H21N3O3/c23-18(14-3-4-14)20-15-5-7-16(8-6-15)21-9-11-22(12-10-21)19(24)17-2-1-13-25-17/h1-2,5-8,13-14H,3-4,9-12H2,(H,20,23) |
| InChIKey | KQWWPENPGYVFDC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|