C19H21N3O4 — CID 39279841
N-[4-(2-amino-2-oxoethyl)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide (PubChem CID 39279841) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 39279841 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide |
| SMILES | NC(=O)Cc1ccc(NC(=O)C2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O4/c20-17(23)12-13-3-5-15(6-4-13)21-18(24)14-7-9-22(10-8-14)19(25)16-2-1-11-26-16/h1-6,11,14H,7-10,12H2,(H2,20,23)(H,21,24) |
| InChIKey | DTLUCWMZPUJTLX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |