C21H23N3O6 — CID 46828250
methyl 2-[[4-[[1-(furan-2-carbonyl)piperidine-4-carbonyl]amino]benzoyl]amino]acetate (PubChem CID 46828250) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is methyl 2-[[4-[[1-(furan-2-carbonyl)piperidine-4-carbonyl]amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[[1-(furan-2-carbonyl)piperidine-4-carbonyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 46828250 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | methyl 2-[[4-[[1-(furan-2-carbonyl)piperidine-4-carbonyl]amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)C2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C21H23N3O6/c1-29-18(25)13-22-19(26)14-4-6-16(7-5-14)23-20(27)15-8-10-24(11-9-15)21(28)17-3-2-12-30-17/h2-7,12,15H,8-11,13H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | DOYZNJXVYIIVRX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |