C22H21N3O5 — CID 55567441
1-(furan-3-carbonyl)-N-[4-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide (PubChem CID 55567441) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is 1-(furan-3-carbonyl)-N-[4-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(furan-3-carbonyl)-N-[4-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55567441 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-(furan-3-carbonyl)-N-[4-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)C2CCN(C(=O)c3ccoc3)CC2)cc1)c1ccco1 |
| InChI | InChI=1S/C22H21N3O5/c26-20(15-7-10-25(11-8-15)22(28)16-9-13-29-14-16)23-17-3-5-18(6-4-17)24-21(27)19-2-1-12-30-19/h1-6,9,12-15H,7-8,10-11H2,(H,23,26)(H,24,27) |
| InChIKey | REZROLUAYQTFLH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |