C20H23N3O4S — CID 56529937
S-[4-[[1-(furan-2-carbonyl)piperidine-4-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56529937) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is S-[4-[[1-(furan-2-carbonyl)piperidine-4-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[[1-(furan-2-carbonyl)piperidine-4-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56529937 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | S-[4-[[1-(furan-2-carbonyl)piperidine-4-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)C2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O4S/c1-22(2)20(26)28-16-7-5-15(6-8-16)21-18(24)14-9-11-23(12-10-14)19(25)17-4-3-13-27-17/h3-8,13-14H,9-12H2,1-2H3,(H,21,24) |
| InChIKey | ZDHUEFFEVRRVKT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|