C23H31N3O5S — CID 17081719
N-[4-(dipropylsulfamoyl)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide (PubChem CID 17081719) has the molecular formula C23H31N3O5S and a molecular weight of 461.58 g/mol. Its IUPAC name is N-[4-(dipropylsulfamoyl)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[4-(dipropylsulfamoyl)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17081719 |
| Molecular Formula | C23H31N3O5S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-[4-(dipropylsulfamoyl)phenyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NC(=O)C2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O5S/c1-3-13-26(14-4-2)32(29,30)20-9-7-19(8-10-20)24-22(27)18-11-15-25(16-12-18)23(28)21-6-5-17-31-21/h5-10,17-18H,3-4,11-16H2,1-2H3,(H,24,27) |
| InChIKey | JOHTYCGHVPUGAU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |