C27H36ClN3O4S — CID 17223474
1-(2-chlorobenzoyl)-N-[4-(dibutylsulfamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 17223474) has the molecular formula C27H36ClN3O4S and a molecular weight of 534.12 g/mol. Its IUPAC name is 1-(2-chlorobenzoyl)-N-[4-(dibutylsulfamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-chlorobenzoyl)-N-[4-(dibutylsulfamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17223474 |
| Molecular Formula | C27H36ClN3O4S |
| Molecular Weight | 534.12 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 1-(2-chlorobenzoyl)-N-[4-(dibutylsulfamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(NC(=O)C2CCN(C(=O)c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C27H36ClN3O4S/c1-3-5-17-31(18-6-4-2)36(34,35)23-13-11-22(12-14-23)29-26(32)21-15-19-30(20-16-21)27(33)24-9-7-8-10-25(24)28/h7-14,21H,3-6,15-20H2,1-2H3,(H,29,32) |
| InChIKey | IYYBPEYPXUNZKN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.12 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |